C25H29O8- — CID 18335867
11-methyl-3-[(1E,3E)-5-(11-methyl-2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate (PubChem CID 18335867) has the molecular formula C25H29O8- and a molecular weight of 457.50 g/mol. Its IUPAC name is 11-methyl-3-[(1E,3E)-5-(11-methyl-2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate.
| Compound Name | 11-methyl-3-[(1E,3E)-5-(11-methyl-2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
|---|---|
| PubChem CID | 18335867 |
| Molecular Formula | C25H29O8- |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 11-methyl-3-[(1E,3E)-5-(11-methyl-2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
| SMILES | CC1CCCCC12OC(=O)C(=C/C=C/C=C/C1=C([O-])OC3(CCCCC3C)OC1=O)C(=O)O2 |
| InChI | InChI=1S/C25H30O8/c1-16-10-6-8-14-24(16)30-20(26)18(21(27)31-24)12-4-3-5-13-19-22(28)32-25(33-23(19)29)15-9-7-11-17(25)2/h3-5,12-13,16-17,26H,6-11,14-15H2,1-2H3/p-1/b5-3+,12-4+,19-13- |
| InChIKey | XVHNHKIBXZSCNE-QWBDDDIYSA-M |
| XLogP | 3.08 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|