C23H25O8- — CID 20754294
3-[(1E,3E)-5-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate (PubChem CID 20754294) has the molecular formula C23H25O8- and a molecular weight of 429.45 g/mol. Its IUPAC name is 3-[(1E,3E)-5-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate.
| Compound Name | 3-[(1E,3E)-5-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
|---|---|
| PubChem CID | 20754294 |
| Molecular Formula | C23H25O8- |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 3-[(1E,3E)-5-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)penta-1,3-dienyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
| SMILES | O=C1OC2(CCCCC2)OC(=O)C1=C/C=C/C=C/C1=C([O-])OC2(CCCCC2)OC1=O |
| InChI | InChI=1S/C23H26O8/c24-18-16(19(25)29-22(28-18)12-6-2-7-13-22)10-4-1-5-11-17-20(26)30-23(31-21(17)27)14-8-3-9-15-23/h1,4-5,10-11,24H,2-3,6-9,12-15H2/p-1/b5-1+,10-4+ |
| InChIKey | MUNQYDGVYJUZFB-YTIQKUADSA-M |
| XLogP | 2.59 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|