C21H23O8- — CID 20754292
3-[(1E,3E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)penta-1,3-dienyl]-11-methyl-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate (PubChem CID 20754292) has the molecular formula C21H23O8- and a molecular weight of 403.41 g/mol. Its IUPAC name is 3-[(1E,3E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)penta-1,3-dienyl]-11-methyl-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate.
| Compound Name | 3-[(1E,3E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)penta-1,3-dienyl]-11-methyl-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
|---|---|
| PubChem CID | 20754292 |
| Molecular Formula | C21H23O8- |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-[(1E,3E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)penta-1,3-dienyl]-11-methyl-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
| SMILES | CC1CCCCC12OC(=O)C(/C=C/C=C/C=C1C(=O)OC(C)(C)OC1=O)=C([O-])O2 |
| InChI | InChI=1S/C21H24O8/c1-13-9-7-8-12-21(13)28-18(24)15(19(25)29-21)11-6-4-5-10-14-16(22)26-20(2,3)27-17(14)23/h4-6,10-11,13,24H,7-9,12H2,1-3H3/p-1/b5-4+,11-6+ |
| InChIKey | ISYQMQIKZLEPHI-LJIKRCSCSA-M |
| XLogP | 1.91 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|