About 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one
5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one (PubChem CID 12641485) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one.
Analyze 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one?
The IUPAC name of 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one (CID 12641485) is 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one.
What is the SMILES notation for 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one?
The canonical SMILES for 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one is CCC(O)C1(C)OC(C)(C)OC1=O.
What is the InChIKey of 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one?
The InChIKey is GPQLFYGWFJTOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-5-6(10)9(4)7(11)12-8(2,3)13-9/h6,10H,5H2,1-4H3.
What are the key properties of 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one?
5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one has a molecular weight of 188.22 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-hydroxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-one is sourced from PubChem (CID 12641485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).