5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid

C6H11O7P — CID 157068817

IUPAC5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid
SMILESCC1=CC(C)(O)OC1=O.O=P(O)(O)O
InChIInChI=1S/C6H8O3.H3O4P/c1-4-3-6(2,8)9-5(4)7;1-5(2,3)4/h3,8H,1-2H3;(H3,1,2,3,4)
InChIKeyACENQBJDUGOZMS-UHFFFAOYSA-N
MW226.12 g/mol
LogP-0.73
Rot. Bonds

About 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid

5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid (PubChem CID 157068817) has the molecular formula C6H11O7P and a molecular weight of 226.12 g/mol. Its IUPAC name is 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid.

Molecular Properties

Compound Name5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid
PubChem CID157068817
Molecular FormulaC6H11O7P
Molecular Weight226.12 g/mol
Exact Mass226.02
IUPAC Name5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid
SMILESCC1=CC(C)(O)OC1=O.O=P(O)(O)O
InChIInChI=1S/C6H8O3.H3O4P/c1-4-3-6(2,8)9-5(4)7;1-5(2,3)4/h3,8H,1-2H3;(H3,1,2,3,4)
InChIKeyACENQBJDUGOZMS-UHFFFAOYSA-N
XLogP-0.73
TPSA124.29 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.12
LogP ≤ 5-0.73
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid?
The IUPAC name of 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid (CID 157068817) is 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid.
What is the SMILES notation for 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid?
The canonical SMILES for 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid is CC1=CC(C)(O)OC1=O.O=P(O)(O)O.
What is the InChIKey of 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid?
The InChIKey is ACENQBJDUGOZMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.H3O4P/c1-4-3-6(2,8)9-5(4)7;1-5(2,3)4/h3,8H,1-2H3;(H3,1,2,3,4).
What are the key properties of 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid?
5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid has a molecular weight of 226.12 g/mol, XLogP of -0.73, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid is sourced from PubChem (CID 157068817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).