C6H11O7P — CID 157068817
5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid (PubChem CID 157068817) has the molecular formula C6H11O7P and a molecular weight of 226.12 g/mol. Its IUPAC name is 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid.
| Compound Name | 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid |
|---|---|
| PubChem CID | 157068817 |
| Molecular Formula | C6H11O7P |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 5-hydroxy-3,5-dimethylfuran-2-one;phosphoric acid |
| SMILES | CC1=CC(C)(O)OC1=O.O=P(O)(O)O |
| InChI | InChI=1S/C6H8O3.H3O4P/c1-4-3-6(2,8)9-5(4)7;1-5(2,3)4/h3,8H,1-2H3;(H3,1,2,3,4) |
| InChIKey | ACENQBJDUGOZMS-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|