C10H17O5P — CID 151266368
(3,6-dimethoxy-1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphonic acid (PubChem CID 151266368) has the molecular formula C10H17O5P and a molecular weight of 248.21 g/mol. Its IUPAC name is (3,6-dimethoxy-1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphonic acid.
| Compound Name | (3,6-dimethoxy-1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphonic acid |
|---|---|
| PubChem CID | 151266368 |
| Molecular Formula | C10H17O5P |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (3,6-dimethoxy-1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphonic acid |
| SMILES | COC1=CC(C)(P(=O)(O)O)C(OC)C=C1C |
| InChI | InChI=1S/C10H17O5P/c1-7-5-9(15-4)10(2,16(11,12)13)6-8(7)14-3/h5-6,9H,1-4H3,(H2,11,12,13) |
| InChIKey | NVKWDMJXNAZEAO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|