C11H16O3 — CID 142154415
3,7-dimethoxy-2,5-dimethylcyclohepta-1,3,5-trien-1-ol (PubChem CID 142154415) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3,7-dimethoxy-2,5-dimethylcyclohepta-1,3,5-trien-1-ol.
| Compound Name | 3,7-dimethoxy-2,5-dimethylcyclohepta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 142154415 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3,7-dimethoxy-2,5-dimethylcyclohepta-1,3,5-trien-1-ol |
| SMILES | COC1=CC(C)=CC(OC)C(O)=C1C |
| InChI | InChI=1S/C11H16O3/c1-7-5-9(13-3)8(2)11(12)10(6-7)14-4/h5-6,10,12H,1-4H3 |
| InChIKey | RXINVNGOCWNKOW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |