C9H13BO4 — CID 163717596
(3,5-dimethoxy-6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid (PubChem CID 163717596) has the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. Its IUPAC name is (3,5-dimethoxy-6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid.
| Compound Name | (3,5-dimethoxy-6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 163717596 |
| Molecular Formula | C9H13BO4 |
| Molecular Weight | 196.01 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (3,5-dimethoxy-6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid |
| SMILES | C=C1C(B(O)O)=CC(OC)=CC1OC |
| InChI | InChI=1S/C9H13BO4/c1-6-8(10(11)12)4-7(13-2)5-9(6)14-3/h4-5,9,11-12H,1H2,2-3H3 |
| InChIKey | KOSDZRKADVJBPZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.01 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|