About (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one
(5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one (PubChem CID 131162625) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one.
Analyze (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one?
The IUPAC name of (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one (CID 131162625) is (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one.
What is the SMILES notation for (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one?
The canonical SMILES for (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one is CC1=CC(C)(C)[C@H](O)C1=O.
What is the InChIKey of (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one?
The InChIKey is LKRNQWJBCXSLPF-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12O2/c1-5-4-8(2,3)7(10)6(5)9/h4,7,10H,1-3H3/t7-/m1/s1.
What are the key properties of (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one?
(5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one has a molecular weight of 140.18 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-hydroxy-2,4,4-trimethylcyclopent-2-en-1-one is sourced from PubChem (CID 131162625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).