C12H19NO — CID 163945176
(3S)-7-ethyl-3,4,4,6-tetramethyl-3H-azepin-2-one (PubChem CID 163945176) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3S)-7-ethyl-3,4,4,6-tetramethyl-3H-azepin-2-one.
| Compound Name | (3S)-7-ethyl-3,4,4,6-tetramethyl-3H-azepin-2-one |
|---|---|
| PubChem CID | 163945176 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3S)-7-ethyl-3,4,4,6-tetramethyl-3H-azepin-2-one |
| SMILES | CCC1=NC(=O)[C@@H](C)C(C)(C)C=C1C |
| InChI | InChI=1S/C12H19NO/c1-6-10-8(2)7-12(4,5)9(3)11(14)13-10/h7,9H,6H2,1-5H3/t9-/m1/s1 |
| InChIKey | RULINTBZAHQDCU-SECBINFHSA-N |
| XLogP | 2.99 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |