C11H14O3S — CID 90813140
4,6,6-trimethyl-2-(2-sulfanylacetyl)cyclohex-4-ene-1,3-dione (PubChem CID 90813140) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 4,6,6-trimethyl-2-(2-sulfanylacetyl)cyclohex-4-ene-1,3-dione.
| Compound Name | 4,6,6-trimethyl-2-(2-sulfanylacetyl)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 90813140 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 4,6,6-trimethyl-2-(2-sulfanylacetyl)cyclohex-4-ene-1,3-dione |
| SMILES | CC1=CC(C)(C)C(=O)C(C(=O)CS)C1=O |
| InChI | InChI=1S/C11H14O3S/c1-6-4-11(2,3)10(14)8(9(6)13)7(12)5-15/h4,8,15H,5H2,1-3H3 |
| InChIKey | FQCYAAZYXOSJQO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|