C15H18O2 — CID 155929549
(3aR,3bR,6aS,7aS)-2,5,7,7-tetramethyl-3a,3b,6a,7a-tetrahydrocyclopenta[a]pentalene-3,4-dione (PubChem CID 155929549) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (3aR,3bR,6aS,7aS)-2,5,7,7-tetramethyl-3a,3b,6a,7a-tetrahydrocyclopenta[a]pentalene-3,4-dione.
| Compound Name | (3aR,3bR,6aS,7aS)-2,5,7,7-tetramethyl-3a,3b,6a,7a-tetrahydrocyclopenta[a]pentalene-3,4-dione |
|---|---|
| PubChem CID | 155929549 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (3aR,3bR,6aS,7aS)-2,5,7,7-tetramethyl-3a,3b,6a,7a-tetrahydrocyclopenta[a]pentalene-3,4-dione |
| SMILES | CC1=C[C@H]2[C@@H](C1=O)[C@@H]1C(=O)C(C)=C[C@@H]1C2(C)C |
| InChI | InChI=1S/C15H18O2/c1-7-5-9-11(13(7)16)12-10(15(9,3)4)6-8(2)14(12)17/h5-6,9-12H,1-4H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | CMMZJHDZPQXSHT-NNYUYHANSA-N |
| XLogP | 2.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |