C20H28O4 — CID 163134846
1,10-dihydroxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadeca-3,14-diene-2,13-dione (PubChem CID 163134846) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1,10-dihydroxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadeca-3,14-diene-2,13-dione.
| Compound Name | 1,10-dihydroxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadeca-3,14-diene-2,13-dione |
|---|---|
| PubChem CID | 163134846 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1,10-dihydroxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadeca-3,14-diene-2,13-dione |
| SMILES | CC1=CC2(O)C(=O)C(C)=CC3C(CCC(C)(O)CC2C1=O)C3(C)C |
| InChI | InChI=1S/C20H28O4/c1-11-8-14-13(18(14,3)4)6-7-19(5,23)10-15-16(21)12(2)9-20(15,24)17(11)22/h8-9,13-15,23-24H,6-7,10H2,1-5H3 |
| InChIKey | HNZIXHILPGPDTD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |