C20H30O5 — CID 162934870
(1R,2S,4S,7S,9R,10E,13R,15R,16R)-13,15,16-trihydroxy-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-12-one (PubChem CID 162934870) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1R,2S,4S,7S,9R,10E,13R,15R,16R)-13,15,16-trihydroxy-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-12-one.
| Compound Name | (1R,2S,4S,7S,9R,10E,13R,15R,16R)-13,15,16-trihydroxy-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-12-one |
|---|---|
| PubChem CID | 162934870 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1R,2S,4S,7S,9R,10E,13R,15R,16R)-13,15,16-trihydroxy-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-12-one |
| SMILES | C/C1=C\[C@@H]2[C@H](CC[C@]3(C)O[C@H]3[C@H]3[C@@H](O)[C@](C)(O)C[C@]3(O)C1=O)C2(C)C |
| InChI | InChI=1S/C20H30O5/c1-10-8-12-11(17(12,2)3)6-7-19(5)16(25-19)13-15(22)18(4,23)9-20(13,24)14(10)21/h8,11-13,15-16,22-24H,6-7,9H2,1-5H3/b10-8+/t11-,12+,13+,15+,16-,18+,19-,20+/m0/s1 |
| InChIKey | PSYHYARVKXLDQQ-LSWNBBDBSA-N |
| XLogP | 1.59 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|