C36H40O7 — CID 44588924
[(1R,2R,4R,7S,9R,10E,13R,15R,16S)-16-hydroxy-4,8,8,11-tetramethyl-12-oxo-13-[(E)-3-phenylprop-2-enoyl]oxy-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-15-yl]methyl benzoate (PubChem CID 44588924) has the molecular formula C36H40O7 and a molecular weight of 584.71 g/mol. Its IUPAC name is [(1R,2R,4R,7S,9R,10E,13R,15R,16S)-16-hydroxy-4,8,8,11-tetramethyl-12-oxo-13-[(E)-3-phenylprop-2-enoyl]oxy-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-15-yl]methyl benzoate.
| Compound Name | [(1R,2R,4R,7S,9R,10E,13R,15R,16S)-16-hydroxy-4,8,8,11-tetramethyl-12-oxo-13-[(E)-3-phenylprop-2-enoyl]oxy-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-15-yl]methyl benzoate |
|---|---|
| PubChem CID | 44588924 |
| Molecular Formula | C36H40O7 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | [(1R,2R,4R,7S,9R,10E,13R,15R,16S)-16-hydroxy-4,8,8,11-tetramethyl-12-oxo-13-[(E)-3-phenylprop-2-enoyl]oxy-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-15-yl]methyl benzoate |
| SMILES | C/C1=C\[C@@H]2[C@H](CC[C@@]3(C)O[C@@H]3[C@H]3[C@@H](O)[C@@H](COC(=O)c4ccccc4)C[C@]3(OC(=O)/C=C/c3ccccc3)C1=O)C2(C)C |
| InChI | InChI=1S/C36H40O7/c1-22-19-27-26(34(27,2)3)17-18-35(4)32(43-35)29-30(38)25(21-41-33(40)24-13-9-6-10-14-24)20-36(29,31(22)39)42-28(37)16-15-23-11-7-5-8-12-23/h5-16,19,25-27,29-30,32,38H,17-18,20-21H2,1-4H3/b16-15+,22-19+/t25-,26+,27-,29-,30+,32-,35-,36-/m1/s1 |
| InChIKey | VPKGGTXXWCTUNI-VGSDHWDASA-N |
| XLogP | 5.57 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|