C28H35NO6 — CID 164613769
[(1R,2R,4S,7S,9R,10E,13R,15S,16S)-13-acetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-16-yl] pyridine-3-carboxylate (PubChem CID 164613769) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is [(1R,2R,4S,7S,9R,10E,13R,15S,16S)-13-acetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-16-yl] pyridine-3-carboxylate.
| Compound Name | [(1R,2R,4S,7S,9R,10E,13R,15S,16S)-13-acetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-16-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164613769 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | [(1R,2R,4S,7S,9R,10E,13R,15S,16S)-13-acetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-10-en-16-yl] pyridine-3-carboxylate |
| SMILES | CC(=O)O[C@]12C[C@H](C)[C@H](OC(=O)c3cccnc3)[C@@H]1[C@H]1O[C@@]1(C)CC[C@H]1[C@@H](/C=C(\C)C2=O)C1(C)C |
| InChI | InChI=1S/C28H35NO6/c1-15-12-20-19(26(20,4)5)9-10-27(6)24(35-27)21-22(33-25(32)18-8-7-11-29-14-18)16(2)13-28(21,23(15)31)34-17(3)30/h7-8,11-12,14,16,19-22,24H,9-10,13H2,1-6H3/b15-12+/t16-,19-,20+,21+,22-,24+,27-,28+/m0/s1 |
| InChIKey | LDSYBWFFZOMEHD-MCIQLROTSA-N |
| XLogP | 4.30 |
| TPSA | 95.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|