C31H38O8 — CID 171329299
[1,11-diacetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,9-dienyl] benzoate (PubChem CID 171329299) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is [1,11-diacetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,9-dienyl] benzoate.
| Compound Name | [1,11-diacetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,9-dienyl] benzoate |
|---|---|
| PubChem CID | 171329299 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [1,11-diacetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,9-dienyl] benzoate |
| SMILES | CC(=O)OC1C(CO)=CCC2C(C=C(C)C(=O)C3(OC(C)=O)CC(C)C(OC(=O)c4ccccc4)C13)C2(C)C |
| InChI | InChI=1S/C31H38O8/c1-17-14-24-23(30(24,5)6)13-12-22(16-32)27(37-19(3)33)25-26(38-29(36)21-10-8-7-9-11-21)18(2)15-31(25,28(17)35)39-20(4)34/h7-12,14,18,23-27,32H,13,15-16H2,1-6H3 |
| InChIKey | YLLBXYRNXBAADG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|