C37H41NO9 — CID 155539877
[(1R,3E,5R,7S,9S,11R,12R,13S,14S)-1,11-diacetyloxy-13-benzoyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-9-tricyclo[10.3.0.05,7]pentadec-3-enyl] pyridine-4-carboxylate (PubChem CID 155539877) has the molecular formula C37H41NO9 and a molecular weight of 643.73 g/mol. Its IUPAC name is [(1R,3E,5R,7S,9S,11R,12R,13S,14S)-1,11-diacetyloxy-13-benzoyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-9-tricyclo[10.3.0.05,7]pentadec-3-enyl] pyridine-4-carboxylate.
| Compound Name | [(1R,3E,5R,7S,9S,11R,12R,13S,14S)-1,11-diacetyloxy-13-benzoyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-9-tricyclo[10.3.0.05,7]pentadec-3-enyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 155539877 |
| Molecular Formula | C37H41NO9 |
| Molecular Weight | 643.73 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | [(1R,3E,5R,7S,9S,11R,12R,13S,14S)-1,11-diacetyloxy-13-benzoyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-9-tricyclo[10.3.0.05,7]pentadec-3-enyl] pyridine-4-carboxylate |
| SMILES | C=C1[C@@H](OC(=O)c2ccncc2)C[C@H]2[C@@H](/C=C(\C)C(=O)[C@@]3(OC(C)=O)C[C@H](C)[C@H](OC(=O)c4ccccc4)[C@@H]3[C@H]1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C37H41NO9/c1-20-17-27-28(36(27,6)7)18-29(45-34(42)26-13-15-38-16-14-26)22(3)32(44-23(4)39)30-31(46-35(43)25-11-9-8-10-12-25)21(2)19-37(30,33(20)41)47-24(5)40/h8-17,21,27-32H,3,18-19H2,1-2,4-7H3/b20-17+/t21-,27+,28-,29-,30+,31-,32-,37+/m0/s1 |
| InChIKey | GMXHRBKIOCHTSX-AEIGCCNQSA-N |
| XLogP | 5.47 |
| TPSA | 135.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|