C32H40O7 — CID 85227957
(1,11-diacetyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl) 2-phenylacetate (PubChem CID 85227957) has the molecular formula C32H40O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is (1,11-diacetyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl) 2-phenylacetate.
| Compound Name | (1,11-diacetyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl) 2-phenylacetate |
|---|---|
| PubChem CID | 85227957 |
| Molecular Formula | C32H40O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (1,11-diacetyloxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl) 2-phenylacetate |
| SMILES | C=C1CCC2C(C=C(C)C(=O)C3(OC(C)=O)CC(C)C(OC(=O)Cc4ccccc4)C3C1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C32H40O7/c1-18-13-14-24-25(31(24,6)7)15-19(2)30(36)32(39-22(5)34)17-20(3)29(27(32)28(18)37-21(4)33)38-26(35)16-23-11-9-8-10-12-23/h8-12,15,20,24-25,27-29H,1,13-14,16-17H2,2-7H3 |
| InChIKey | YTCGWKBKPYSRNN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|