C20H36O2 — CID 155663554
3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol (PubChem CID 155663554) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol.
| Compound Name | 3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 155663554 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
| SMILES | CC1(O)CCC2C(C1)C2(C)C.CC1(O)CCC2C(C1)C2(C)C |
| InChI | InChI=1S/2C10H18O/c2*1-9(2)7-4-5-10(3,11)6-8(7)9/h2*7-8,11H,4-6H2,1-3H3 |
| InChIKey | DGGQSXUHWHRSRJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |