C11H20O2 — CID 23268227
(1S,3R,4S,6R)-3,4,7,7-tetramethylbicyclo[4.1.0]heptane-3,4-diol (PubChem CID 23268227) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1S,3R,4S,6R)-3,4,7,7-tetramethylbicyclo[4.1.0]heptane-3,4-diol.
| Compound Name | (1S,3R,4S,6R)-3,4,7,7-tetramethylbicyclo[4.1.0]heptane-3,4-diol |
|---|---|
| PubChem CID | 23268227 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (1S,3R,4S,6R)-3,4,7,7-tetramethylbicyclo[4.1.0]heptane-3,4-diol |
| SMILES | CC1(C)[C@@H]2C[C@](C)(O)[C@](C)(O)C[C@@H]21 |
| InChI | InChI=1S/C11H20O2/c1-9(2)7-5-10(3,12)11(4,13)6-8(7)9/h7-8,12-13H,5-6H2,1-4H3/t7-,8+,10+,11- |
| InChIKey | ZEXXQGQQWIRYMZ-YDRMRZIKSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |