C13H26O2Si — CID 11139315
(1S,3S,4R,6R)-3,7,7-trimethyl-4-trimethylsilyloxybicyclo[4.1.0]heptan-3-ol (PubChem CID 11139315) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is (1S,3S,4R,6R)-3,7,7-trimethyl-4-trimethylsilyloxybicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1S,3S,4R,6R)-3,7,7-trimethyl-4-trimethylsilyloxybicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 11139315 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (1S,3S,4R,6R)-3,7,7-trimethyl-4-trimethylsilyloxybicyclo[4.1.0]heptan-3-ol |
| SMILES | CC1(C)[C@@H]2C[C@@H](O[Si](C)(C)C)[C@@](C)(O)C[C@@H]21 |
| InChI | InChI=1S/C13H26O2Si/c1-12(2)9-7-11(15-16(4,5)6)13(3,14)8-10(9)12/h9-11,14H,7-8H2,1-6H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | HQNKDOYHXFEJJR-XZUYRWCXSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|