C11H20O2 — CID 59057770
(1S,6R)-4-methoxy-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol (PubChem CID 59057770) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1S,6R)-4-methoxy-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1S,6R)-4-methoxy-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 59057770 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (1S,6R)-4-methoxy-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
| SMILES | COC1C[C@@H]2[C@H](CC1(C)O)C2(C)C |
| InChI | InChI=1S/C11H20O2/c1-10(2)7-5-9(13-4)11(3,12)6-8(7)10/h7-9,12H,5-6H2,1-4H3/t7-,8+,9?,11?/m1/s1 |
| InChIKey | PAKVWJXCMMKYGQ-KZNVNZARSA-N |
| XLogP | 1.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |