C32H50O7 — CID 56841535
[(1'R,2R,3'Z,5'R,7'S,12'R,13'S,14'S)-11'-hexanoyloxy-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] hexanoate (PubChem CID 56841535) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is [(1'R,2R,3'Z,5'R,7'S,12'R,13'S,14'S)-11'-hexanoyloxy-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] hexanoate.
| Compound Name | [(1'R,2R,3'Z,5'R,7'S,12'R,13'S,14'S)-11'-hexanoyloxy-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] hexanoate |
|---|---|
| PubChem CID | 56841535 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | [(1'R,2R,3'Z,5'R,7'S,12'R,13'S,14'S)-11'-hexanoyloxy-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1[C@H]2[C@@H](OC(=O)CCCCC)[C@@H](C)C[C@]2(O)C(=O)/C(C)=C\[C@@H]2[C@H](CC[C@@]13CO3)C2(C)C |
| InChI | InChI=1S/C32H50O7/c1-7-9-11-13-24(33)38-27-21(4)18-32(36)26(27)29(39-25(34)14-12-10-8-2)31(19-37-31)16-15-22-23(30(22,5)6)17-20(3)28(32)35/h17,21-23,26-27,29,36H,7-16,18-19H2,1-6H3/b20-17-/t21-,22-,23+,26+,27-,29?,31+,32+/m0/s1 |
| InChIKey | JHLROCVASABBRC-PJKJILQDSA-N |
| XLogP | 5.71 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|