C12H19BrO2 — CID 176937334
4-(bromomethyl)-2-[(Z)-2-methylbut-2-enyl]-2H-furan-5-one;ethane (PubChem CID 176937334) has the molecular formula C12H19BrO2 and a molecular weight of 275.19 g/mol. Its IUPAC name is 4-(bromomethyl)-2-[(Z)-2-methylbut-2-enyl]-2H-furan-5-one;ethane.
| Compound Name | 4-(bromomethyl)-2-[(Z)-2-methylbut-2-enyl]-2H-furan-5-one;ethane |
|---|---|
| PubChem CID | 176937334 |
| Molecular Formula | C12H19BrO2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-(bromomethyl)-2-[(Z)-2-methylbut-2-enyl]-2H-furan-5-one;ethane |
| SMILES | C/C=C(/C)CC1C=C(CBr)C(=O)O1.CC |
| InChI | InChI=1S/C10H13BrO2.C2H6/c1-3-7(2)4-9-5-8(6-11)10(12)13-9;1-2/h3,5,9H,4,6H2,1-2H3;1-2H3/b7-3-; |
| InChIKey | DHHTUVLSJLFDMR-WYLUAFJRSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|