C15H24O4 — CID 70279242
(2R)-2-[(E,6S)-7-hydroxy-2,6-dimethylhept-2-enyl]-3-methoxy-4-methyl-2H-furan-5-one (PubChem CID 70279242) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (2R)-2-[(E,6S)-7-hydroxy-2,6-dimethylhept-2-enyl]-3-methoxy-4-methyl-2H-furan-5-one.
| Compound Name | (2R)-2-[(E,6S)-7-hydroxy-2,6-dimethylhept-2-enyl]-3-methoxy-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 70279242 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (2R)-2-[(E,6S)-7-hydroxy-2,6-dimethylhept-2-enyl]-3-methoxy-4-methyl-2H-furan-5-one |
| SMILES | COC1=C(C)C(=O)O[C@@H]1C/C(C)=C/CC[C@H](C)CO |
| InChI | InChI=1S/C15H24O4/c1-10(6-5-7-11(2)9-16)8-13-14(18-4)12(3)15(17)19-13/h6,11,13,16H,5,7-9H2,1-4H3/b10-6+/t11-,13+/m0/s1 |
| InChIKey | VVSIQFQHZHNXPV-AMLRMPNFSA-N |
| XLogP | 2.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|