C19H28O3 — CID 140821197
(Z)-10-hydroxy-1-(4-methoxyphenyl)-4,8-dimethyldec-4-en-1-one (PubChem CID 140821197) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (Z)-10-hydroxy-1-(4-methoxyphenyl)-4,8-dimethyldec-4-en-1-one.
| Compound Name | (Z)-10-hydroxy-1-(4-methoxyphenyl)-4,8-dimethyldec-4-en-1-one |
|---|---|
| PubChem CID | 140821197 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (Z)-10-hydroxy-1-(4-methoxyphenyl)-4,8-dimethyldec-4-en-1-one |
| SMILES | COc1ccc(C(=O)CC/C(C)=C\CCC(C)CCO)cc1 |
| InChI | InChI=1S/C19H28O3/c1-15(5-4-6-16(2)13-14-20)7-12-19(21)17-8-10-18(22-3)11-9-17/h5,8-11,16,20H,4,6-7,12-14H2,1-3H3/b15-5- |
| InChIKey | LYSTUQCMNCXJFU-WCSRMQSCSA-N |
| XLogP | 4.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|