C25H36O3 — CID 155024023
(2E)-2-[(4-methoxyphenyl)methylidene]-5,9,13-trimethyltetradeca-8,12-dienoic acid (PubChem CID 155024023) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (2E)-2-[(4-methoxyphenyl)methylidene]-5,9,13-trimethyltetradeca-8,12-dienoic acid.
| Compound Name | (2E)-2-[(4-methoxyphenyl)methylidene]-5,9,13-trimethyltetradeca-8,12-dienoic acid |
|---|---|
| PubChem CID | 155024023 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (2E)-2-[(4-methoxyphenyl)methylidene]-5,9,13-trimethyltetradeca-8,12-dienoic acid |
| SMILES | COc1ccc(/C=C(\CCC(C)CCC=C(C)CCC=C(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C25H36O3/c1-19(2)8-6-9-20(3)10-7-11-21(4)12-15-23(25(26)27)18-22-13-16-24(28-5)17-14-22/h8,10,13-14,16-18,21H,6-7,9,11-12,15H2,1-5H3,(H,26,27)/b20-10?,23-18+ |
| InChIKey | JTAMZMJVJMNATI-OCXZQTGESA-N |
| XLogP | 7.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|