C17H30O2 — CID 160955603
2,6-dimethylhepta-2,5-diene;(3S)-3-hydroxy-6-methylhept-5-en-2-one (PubChem CID 160955603) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 2,6-dimethylhepta-2,5-diene;(3S)-3-hydroxy-6-methylhept-5-en-2-one.
| Compound Name | 2,6-dimethylhepta-2,5-diene;(3S)-3-hydroxy-6-methylhept-5-en-2-one |
|---|---|
| PubChem CID | 160955603 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2,6-dimethylhepta-2,5-diene;(3S)-3-hydroxy-6-methylhept-5-en-2-one |
| SMILES | CC(=O)[C@@H](O)CC=C(C)C.CC(C)=CCC=C(C)C |
| InChI | InChI=1S/C9H16.C8H14O2/c1-8(2)6-5-7-9(3)4;1-6(2)4-5-8(10)7(3)9/h6-7H,5H2,1-4H3;4,8,10H,5H2,1-3H3/t;8-/m.0/s1 |
| InChIKey | SWINGGAXRXIHMV-WDBKTSHHSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|