C15H24I2O2 — CID 160611490
(Z,3S)-3-hydroxy-6-iodohept-5-en-2-one;(2Z)-2-iodo-6-methylhepta-2,5-diene (PubChem CID 160611490) has the molecular formula C15H24I2O2 and a molecular weight of 490.16 g/mol. Its IUPAC name is (Z,3S)-3-hydroxy-6-iodohept-5-en-2-one;(2Z)-2-iodo-6-methylhepta-2,5-diene.
| Compound Name | (Z,3S)-3-hydroxy-6-iodohept-5-en-2-one;(2Z)-2-iodo-6-methylhepta-2,5-diene |
|---|---|
| PubChem CID | 160611490 |
| Molecular Formula | C15H24I2O2 |
| Molecular Weight | 490.16 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | (Z,3S)-3-hydroxy-6-iodohept-5-en-2-one;(2Z)-2-iodo-6-methylhepta-2,5-diene |
| SMILES | CC(=O)[C@@H](O)C/C=C(/C)I.CC(C)=CC/C=C(/C)I |
| InChI | InChI=1S/C8H13I.C7H11IO2/c1-7(2)5-4-6-8(3)9;1-5(8)3-4-7(10)6(2)9/h5-6H,4H2,1-3H3;3,7,10H,4H2,1-2H3/b8-6-;5-3-/t;7-/m.0/s1 |
| InChIKey | RFNTXMOCDBAOSQ-GKDBLCCFSA-N |
| XLogP | 5.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.16 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|