C8H14INO3 — CID 59990586
(Z,2S)-2-hydroxy-5-iodo-N-methoxy-N-methylhex-4-enamide (PubChem CID 59990586) has the molecular formula C8H14INO3 and a molecular weight of 299.11 g/mol. Its IUPAC name is (Z,2S)-2-hydroxy-5-iodo-N-methoxy-N-methylhex-4-enamide.
| Compound Name | (Z,2S)-2-hydroxy-5-iodo-N-methoxy-N-methylhex-4-enamide |
|---|---|
| PubChem CID | 59990586 |
| Molecular Formula | C8H14INO3 |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | (Z,2S)-2-hydroxy-5-iodo-N-methoxy-N-methylhex-4-enamide |
| SMILES | CON(C)C(=O)[C@@H](O)C/C=C(/C)I |
| InChI | InChI=1S/C8H14INO3/c1-6(9)4-5-7(11)8(12)10(2)13-3/h4,7,11H,5H2,1-3H3/b6-4-/t7-/m0/s1 |
| InChIKey | WBFLLRJXDGMTKO-NGAMADIESA-N |
| XLogP | 1.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|