C10H18O2 — CID 88527000
(2E)-2-ethyl-6-methylhepta-2,5-diene-1,1-diol (PubChem CID 88527000) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (2E)-2-ethyl-6-methylhepta-2,5-diene-1,1-diol.
| Compound Name | (2E)-2-ethyl-6-methylhepta-2,5-diene-1,1-diol |
|---|---|
| PubChem CID | 88527000 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2E)-2-ethyl-6-methylhepta-2,5-diene-1,1-diol |
| SMILES | CC/C(=C\CC=C(C)C)C(O)O |
| InChI | InChI=1S/C10H18O2/c1-4-9(10(11)12)7-5-6-8(2)3/h6-7,10-12H,4-5H2,1-3H3/b9-7+ |
| InChIKey | GDVQVORSILBEEF-VQHVLOKHSA-N |
| XLogP | 1.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|