C8H13I — CID 71330256
2-iodo-6-methylhepta-2,5-diene (PubChem CID 71330256) has the molecular formula C8H13I and a molecular weight of 236.10 g/mol. Its IUPAC name is 2-iodo-6-methylhepta-2,5-diene.
| Compound Name | 2-iodo-6-methylhepta-2,5-diene |
|---|---|
| PubChem CID | 71330256 |
| Molecular Formula | C8H13I |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 2-iodo-6-methylhepta-2,5-diene |
| SMILES | CC(C)=CCC=C(C)I |
| InChI | InChI=1S/C8H13I/c1-7(2)5-4-6-8(3)9/h5-6H,4H2,1-3H3 |
| InChIKey | ZHTKSTSBVFANCD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|