C8H13F — CID 143576133
(2E)-2-fluoro-6-methylhepta-2,5-diene (PubChem CID 143576133) has the molecular formula C8H13F and a molecular weight of 128.19 g/mol. Its IUPAC name is (2E)-2-fluoro-6-methylhepta-2,5-diene.
| Compound Name | (2E)-2-fluoro-6-methylhepta-2,5-diene |
|---|---|
| PubChem CID | 143576133 |
| Molecular Formula | C8H13F |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.10 |
| IUPAC Name | (2E)-2-fluoro-6-methylhepta-2,5-diene |
| SMILES | CC(C)=CC/C=C(\C)F |
| InChI | InChI=1S/C8H13F/c1-7(2)5-4-6-8(3)9/h5-6H,4H2,1-3H3/b8-6+ |
| InChIKey | WDEXTPJIKRXPOP-SOFGYWHQSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|