C12H20O — CID 5369930
(5E)-5,9-dimethyldeca-5,8-dien-2-one (PubChem CID 5369930) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (5E)-5,9-dimethyldeca-5,8-dien-2-one.
| Compound Name | (5E)-5,9-dimethyldeca-5,8-dien-2-one |
|---|---|
| PubChem CID | 5369930 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (5E)-5,9-dimethyldeca-5,8-dien-2-one |
| SMILES | CC(=O)CC/C(C)=C/CC=C(C)C |
| InChI | InChI=1S/C12H20O/c1-10(2)6-5-7-11(3)8-9-12(4)13/h6-7H,5,8-9H2,1-4H3/b11-7+ |
| InChIKey | UUXRFMARQFDGHE-YRNVUSSQSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|