C14H26O2Si — CID 102462624
(5Z,8Z)-5-methyl-9-trimethylsilyloxydeca-5,8-dien-2-one (PubChem CID 102462624) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is (5Z,8Z)-5-methyl-9-trimethylsilyloxydeca-5,8-dien-2-one.
| Compound Name | (5Z,8Z)-5-methyl-9-trimethylsilyloxydeca-5,8-dien-2-one |
|---|---|
| PubChem CID | 102462624 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (5Z,8Z)-5-methyl-9-trimethylsilyloxydeca-5,8-dien-2-one |
| SMILES | CC(=O)CC/C(C)=C\C/C=C(/C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-12(10-11-13(2)15)8-7-9-14(3)16-17(4,5)6/h8-9H,7,10-11H2,1-6H3/b12-8-,14-9- |
| InChIKey | HPXSZNAWCJGIOL-RXAUVDRZSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|