C18H38O2Si2 — CID 11371297
trimethyl-[(2E,6E)-4,4,5,5-tetramethyl-7-trimethylsilyloxyocta-2,6-dien-2-yl]oxysilane (PubChem CID 11371297) has the molecular formula C18H38O2Si2 and a molecular weight of 342.67 g/mol. Its IUPAC name is trimethyl-[(2E,6E)-4,4,5,5-tetramethyl-7-trimethylsilyloxyocta-2,6-dien-2-yl]oxysilane.
| Compound Name | trimethyl-[(2E,6E)-4,4,5,5-tetramethyl-7-trimethylsilyloxyocta-2,6-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 11371297 |
| Molecular Formula | C18H38O2Si2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | trimethyl-[(2E,6E)-4,4,5,5-tetramethyl-7-trimethylsilyloxyocta-2,6-dien-2-yl]oxysilane |
| SMILES | C/C(=C\C(C)(C)C(C)(C)/C=C(\C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H38O2Si2/c1-15(19-21(7,8)9)13-17(3,4)18(5,6)14-16(2)20-22(10,11)12/h13-14H,1-12H3/b15-13+,16-14+ |
| InChIKey | QMYFXVHEENVSBS-WXUKJITCSA-N |
| XLogP | 6.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|