C8H18OSSi — CID 13171693
O-trimethylsilyl 2,2-dimethylpropanethioate (PubChem CID 13171693) has the molecular formula C8H18OSSi and a molecular weight of 190.38 g/mol. Its IUPAC name is O-trimethylsilyl 2,2-dimethylpropanethioate.
| Compound Name | O-trimethylsilyl 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 13171693 |
| Molecular Formula | C8H18OSSi |
| Molecular Weight | 190.38 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | O-trimethylsilyl 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=S)O[Si](C)(C)C |
| InChI | InChI=1S/C8H18OSSi/c1-8(2,3)7(10)9-11(4,5)6/h1-6H3 |
| InChIKey | IUGOFJIVWOEXIT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|