methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate

C13H26O3Si — CID 18541895

IUPACmethyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate
SMILESCOC(=O)C/C(C)=C(\O[Si](C)(C)C)C(C)(C)C
InChIInChI=1S/C13H26O3Si/c1-10(9-11(14)15-5)12(13(2,3)4)16-17(6,7)8/h9H2,1-8H3/b12-10-
InChIKeyQIYRVRBMVSPRJN-BENRWUELSA-N
MW258.43 g/mol
LogP3.72
Rot. Bonds4

About methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate

methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate (PubChem CID 18541895) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate.

Molecular Properties

Compound Namemethyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate
PubChem CID18541895
Molecular FormulaC13H26O3Si
Molecular Weight258.43 g/mol
Exact Mass258.17
IUPAC Namemethyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate
SMILESCOC(=O)C/C(C)=C(\O[Si](C)(C)C)C(C)(C)C
InChIInChI=1S/C13H26O3Si/c1-10(9-11(14)15-5)12(13(2,3)4)16-17(6,7)8/h9H2,1-8H3/b12-10-
InChIKeyQIYRVRBMVSPRJN-BENRWUELSA-N
XLogP3.72
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.43
LogP ≤ 53.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate?
The IUPAC name of methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate (CID 18541895) is methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate.
What is the SMILES notation for methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate?
The canonical SMILES for methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate is COC(=O)C/C(C)=C(\O[Si](C)(C)C)C(C)(C)C.
What is the InChIKey of methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate?
The InChIKey is QIYRVRBMVSPRJN-BENRWUELSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-10(9-11(14)15-5)12(13(2,3)4)16-17(6,7)8/h9H2,1-8H3/b12-10-.
What are the key properties of methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate?
methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate has a molecular weight of 258.43 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3,5,5-trimethyl-4-trimethylsilyloxyhex-3-enoate is sourced from PubChem (CID 18541895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).