About acetic acid;3-methoxy-3-oxopropanoic acid
acetic acid;3-methoxy-3-oxopropanoic acid (PubChem CID 162325440) has the molecular formula C6H10O6
and a molecular weight of 178.14 g/mol. Its IUPAC name is acetic acid;3-methoxy-3-oxopropanoic acid.
Molecular Properties
| Compound Name | acetic acid;3-methoxy-3-oxopropanoic acid |
| PubChem CID | 162325440 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | acetic acid;3-methoxy-3-oxopropanoic acid |
| SMILES | CC(=O)O.COC(=O)CC(=O)O |
| InChI | InChI=1S/C4H6O4.C2H4O2/c1-8-4(7)2-3(5)6;1-2(3)4/h2H2,1H3,(H,5,6);1H3,(H,3,4) |
| InChIKey | SYUYWGKVQCNLSX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3-methoxy-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-methoxy-3-oxopropanoic acid?
The IUPAC name of acetic acid;3-methoxy-3-oxopropanoic acid (CID 162325440) is acetic acid;3-methoxy-3-oxopropanoic acid.
What is the SMILES notation for acetic acid;3-methoxy-3-oxopropanoic acid?
The canonical SMILES for acetic acid;3-methoxy-3-oxopropanoic acid is CC(=O)O.COC(=O)CC(=O)O.
What is the InChIKey of acetic acid;3-methoxy-3-oxopropanoic acid?
The InChIKey is SYUYWGKVQCNLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.C2H4O2/c1-8-4(7)2-3(5)6;1-2(3)4/h2H2,1H3,(H,5,6);1H3,(H,3,4).
What are the key properties of acetic acid;3-methoxy-3-oxopropanoic acid?
acetic acid;3-methoxy-3-oxopropanoic acid has a molecular weight of 178.14 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-methoxy-3-oxopropanoic acid is sourced from PubChem (CID 162325440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).