About ethane;3-methoxy-3-oxopropanoic acid
ethane;3-methoxy-3-oxopropanoic acid (PubChem CID 91567189) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is ethane;3-methoxy-3-oxopropanoic acid.
Molecular Properties
| Compound Name | ethane;3-methoxy-3-oxopropanoic acid |
| PubChem CID | 91567189 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | ethane;3-methoxy-3-oxopropanoic acid |
| SMILES | CC.COC(=O)CC(=O)O |
| InChI | InChI=1S/C4H6O4.C2H6/c1-8-4(7)2-3(5)6;1-2/h2H2,1H3,(H,5,6);1-2H3 |
| InChIKey | LJQXTVKJZKRSSD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methoxy-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methoxy-3-oxopropanoic acid?
The IUPAC name of ethane;3-methoxy-3-oxopropanoic acid (CID 91567189) is ethane;3-methoxy-3-oxopropanoic acid.
What is the SMILES notation for ethane;3-methoxy-3-oxopropanoic acid?
The canonical SMILES for ethane;3-methoxy-3-oxopropanoic acid is CC.COC(=O)CC(=O)O.
What is the InChIKey of ethane;3-methoxy-3-oxopropanoic acid?
The InChIKey is LJQXTVKJZKRSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.C2H6/c1-8-4(7)2-3(5)6;1-2/h2H2,1H3,(H,5,6);1-2H3.
What are the key properties of ethane;3-methoxy-3-oxopropanoic acid?
ethane;3-methoxy-3-oxopropanoic acid has a molecular weight of 148.16 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methoxy-3-oxopropanoic acid is sourced from PubChem (CID 91567189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).