About methyl 2-bromoacetate
methyl 2-bromoacetate (PubChem CID 10487067) has the molecular formula C3H5BrO2
and a molecular weight of 153.97 g/mol. Its IUPAC name is methyl 2-bromoacetate.
Molecular Properties
| Compound Name | methyl 2-bromoacetate |
| PubChem CID | 10487067 |
| Molecular Formula | C3H5BrO2 |
| Molecular Weight | 153.97 g/mol |
| Exact Mass | 152.95 |
| IUPAC Name | methyl 2-bromoacetate |
| SMILES | COC(=O)[13CH2]Br |
| InChI | InChI=1S/C3H5BrO2/c1-6-3(5)2-4/h2H2,1H3/i2+1 |
| InChIKey | YDCHPLOFQATIDS-VQEHIDDOSA-N |
| XLogP | 0.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.97 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromoacetate?
The IUPAC name of methyl 2-bromoacetate (CID 10487067) is methyl 2-bromoacetate.
What is the SMILES notation for methyl 2-bromoacetate?
The canonical SMILES for methyl 2-bromoacetate is COC(=O)[13CH2]Br.
What is the InChIKey of methyl 2-bromoacetate?
The InChIKey is YDCHPLOFQATIDS-VQEHIDDOSA-N. The full InChI is InChI=1S/C3H5BrO2/c1-6-3(5)2-4/h2H2,1H3/i2+1.
What are the key properties of methyl 2-bromoacetate?
methyl 2-bromoacetate has a molecular weight of 153.97 g/mol, XLogP of 0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromoacetate is sourced from PubChem (CID 10487067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).