About methyl butanoate;tetrahydrochloride
methyl butanoate;tetrahydrochloride (PubChem CID 173289582) has the molecular formula C5H14Cl4O2
and a molecular weight of 247.98 g/mol. Its IUPAC name is methyl butanoate;tetrahydrochloride.
Molecular Properties
| Compound Name | methyl butanoate;tetrahydrochloride |
| PubChem CID | 173289582 |
| Molecular Formula | C5H14Cl4O2 |
| Molecular Weight | 247.98 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | methyl butanoate;tetrahydrochloride |
| SMILES | CCCC(=O)OC.Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C5H10O2.4ClH/c1-3-4-5(6)7-2;;;;/h3-4H2,1-2H3;4*1H |
| InChIKey | ODCPLIHBAQUQER-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.98 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl butanoate;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl butanoate;tetrahydrochloride?
The IUPAC name of methyl butanoate;tetrahydrochloride (CID 173289582) is methyl butanoate;tetrahydrochloride.
What is the SMILES notation for methyl butanoate;tetrahydrochloride?
The canonical SMILES for methyl butanoate;tetrahydrochloride is CCCC(=O)OC.Cl.Cl.Cl.Cl.
What is the InChIKey of methyl butanoate;tetrahydrochloride?
The InChIKey is ODCPLIHBAQUQER-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.4ClH/c1-3-4-5(6)7-2;;;;/h3-4H2,1-2H3;4*1H.
What are the key properties of methyl butanoate;tetrahydrochloride?
methyl butanoate;tetrahydrochloride has a molecular weight of 247.98 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl butanoate;tetrahydrochloride is sourced from PubChem (CID 173289582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).