About 3-ethoxy-3-oxopropanoic acid chloride
3-ethoxy-3-oxopropanoic acid chloride (PubChem CID 21107838) has the molecular formula C5H8ClO4-
and a molecular weight of 167.57 g/mol. Its IUPAC name is 3-ethoxy-3-oxopropanoic acid chloride.
Molecular Properties
| Compound Name | 3-ethoxy-3-oxopropanoic acid chloride |
| PubChem CID | 21107838 |
| Molecular Formula | C5H8ClO4- |
| Molecular Weight | 167.57 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | 3-ethoxy-3-oxopropanoic acid chloride |
| SMILES | CCOC(=O)CC(=O)O.[Cl-] |
| InChI | InChI=1S/C5H8O4.ClH/c1-2-9-5(8)3-4(6)7;/h2-3H2,1H3,(H,6,7);1H/p-1 |
| InChIKey | NBKNFNAHFNVUOW-UHFFFAOYSA-M |
| XLogP | -2.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.57 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-3-oxopropanoic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-3-oxopropanoic acid chloride?
The IUPAC name of 3-ethoxy-3-oxopropanoic acid chloride (CID 21107838) is 3-ethoxy-3-oxopropanoic acid chloride.
What is the SMILES notation for 3-ethoxy-3-oxopropanoic acid chloride?
The canonical SMILES for 3-ethoxy-3-oxopropanoic acid chloride is CCOC(=O)CC(=O)O.[Cl-].
What is the InChIKey of 3-ethoxy-3-oxopropanoic acid chloride?
The InChIKey is NBKNFNAHFNVUOW-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O4.ClH/c1-2-9-5(8)3-4(6)7;/h2-3H2,1H3,(H,6,7);1H/p-1.
What are the key properties of 3-ethoxy-3-oxopropanoic acid chloride?
3-ethoxy-3-oxopropanoic acid chloride has a molecular weight of 167.57 g/mol, XLogP of -2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-3-oxopropanoic acid chloride is sourced from PubChem (CID 21107838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).