C15H30O4Si — CID 71380809
acetic acid;3,7-dimethyl-6-trimethylsilyloxyocta-2,6-dien-1-ol (PubChem CID 71380809) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is acetic acid;3,7-dimethyl-6-trimethylsilyloxyocta-2,6-dien-1-ol.
| Compound Name | acetic acid;3,7-dimethyl-6-trimethylsilyloxyocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 71380809 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | acetic acid;3,7-dimethyl-6-trimethylsilyloxyocta-2,6-dien-1-ol |
| SMILES | CC(=CCO)CCC(O[Si](C)(C)C)=C(C)C.CC(=O)O |
| InChI | InChI=1S/C13H26O2Si.C2H4O2/c1-11(2)13(15-16(4,5)6)8-7-12(3)9-10-14;1-2(3)4/h9,14H,7-8,10H2,1-6H3;1H3,(H,3,4) |
| InChIKey | KCSGGSIYEANQIJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|