C17H28O — CID 145113711
(5E,9E)-11-cyclobutyl-5,9-dimethylundeca-5,9-dien-2-one (PubChem CID 145113711) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (5E,9E)-11-cyclobutyl-5,9-dimethylundeca-5,9-dien-2-one.
| Compound Name | (5E,9E)-11-cyclobutyl-5,9-dimethylundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 145113711 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (5E,9E)-11-cyclobutyl-5,9-dimethylundeca-5,9-dien-2-one |
| SMILES | CC(=O)CC/C(C)=C/CC/C(C)=C/CC1CCC1 |
| InChI | InChI=1S/C17H28O/c1-14(10-12-16(3)18)6-4-7-15(2)11-13-17-8-5-9-17/h6,11,17H,4-5,7-10,12-13H2,1-3H3/b14-6+,15-11+ |
| InChIKey | LNSGCHJLTODBNP-XYKVRWSESA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|