C14H22O — CID 57093023
2,6,10-trimethylundeca-2,6,9-trien-4-one (PubChem CID 57093023) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,6,10-trimethylundeca-2,6,9-trien-4-one.
| Compound Name | 2,6,10-trimethylundeca-2,6,9-trien-4-one |
|---|---|
| PubChem CID | 57093023 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2,6,10-trimethylundeca-2,6,9-trien-4-one |
| SMILES | CC(C)=CCC=C(C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C14H22O/c1-11(2)7-6-8-13(5)10-14(15)9-12(3)4/h7-9H,6,10H2,1-5H3 |
| InChIKey | MUAQUBUDBLWZSY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|