C22H34O6 — CID 162907165
10-(acetyloxymethyl)-16-hydroxy-14-(hydroxymethyl)-2,6-dimethylhexadeca-2,6,10,14-tetraenoic acid (PubChem CID 162907165) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 10-(acetyloxymethyl)-16-hydroxy-14-(hydroxymethyl)-2,6-dimethylhexadeca-2,6,10,14-tetraenoic acid.
| Compound Name | 10-(acetyloxymethyl)-16-hydroxy-14-(hydroxymethyl)-2,6-dimethylhexadeca-2,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 162907165 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 10-(acetyloxymethyl)-16-hydroxy-14-(hydroxymethyl)-2,6-dimethylhexadeca-2,6,10,14-tetraenoic acid |
| SMILES | CC(=O)OCC(=CCCC(=CCO)CO)CCC=C(C)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C22H34O6/c1-17(7-4-9-18(2)22(26)27)8-5-11-21(16-28-19(3)25)12-6-10-20(15-24)13-14-23/h8-9,12-13,23-24H,4-7,10-11,14-16H2,1-3H3,(H,26,27) |
| InChIKey | OVHPIPGQIIWBKM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|