C21H34O3 — CID 163040386
16-hydroxy-10-(hydroxymethyl)-2,3,6,14-tetramethylhexadeca-3,6,10,14-tetraen-5-one (PubChem CID 163040386) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 16-hydroxy-10-(hydroxymethyl)-2,3,6,14-tetramethylhexadeca-3,6,10,14-tetraen-5-one.
| Compound Name | 16-hydroxy-10-(hydroxymethyl)-2,3,6,14-tetramethylhexadeca-3,6,10,14-tetraen-5-one |
|---|---|
| PubChem CID | 163040386 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 16-hydroxy-10-(hydroxymethyl)-2,3,6,14-tetramethylhexadeca-3,6,10,14-tetraen-5-one |
| SMILES | CC(=CCO)CCC=C(CO)CCC=C(C)C(=O)C=C(C)C(C)C |
| InChI | InChI=1S/C21H34O3/c1-16(2)19(5)14-21(24)18(4)9-7-11-20(15-23)10-6-8-17(3)12-13-22/h9-10,12,14,16,22-23H,6-8,11,13,15H2,1-5H3 |
| InChIKey | TXHUPZWOUSBILR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|