C21H36O2 — CID 162914252
(E)-2-[(3E,7E,10S)-4,8,10,12-tetramethyltrideca-3,7,11-trienyl]but-2-ene-1,4-diol (PubChem CID 162914252) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (E)-2-[(3E,7E,10S)-4,8,10,12-tetramethyltrideca-3,7,11-trienyl]but-2-ene-1,4-diol.
| Compound Name | (E)-2-[(3E,7E,10S)-4,8,10,12-tetramethyltrideca-3,7,11-trienyl]but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 162914252 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (E)-2-[(3E,7E,10S)-4,8,10,12-tetramethyltrideca-3,7,11-trienyl]but-2-ene-1,4-diol |
| SMILES | CC(C)=C[C@@H](C)C/C(C)=C/CC/C(C)=C/CC/C(=C\CO)CO |
| InChI | InChI=1S/C21H36O2/c1-17(2)14-20(5)15-19(4)10-6-8-18(3)9-7-11-21(16-23)12-13-22/h9-10,12,14,20,22-23H,6-8,11,13,15-16H2,1-5H3/b18-9+,19-10+,21-12+/t20-/m1/s1 |
| InChIKey | OIMAKPRCKIKPRX-NMJLTDNMSA-N |
| XLogP | 5.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|